CAS 1174307-69-7 appears in our catalog under these names: 2-(Chloromethyl)-7-methylimidazo[1,2-a]pyridine hydrochloride, 95%, 2-(Chloromethyl)-7-methylimidazo(1,2-a)pyridine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
2-(chloromethyl)-7-methylimidazo[1,2-a]pyridine;hydrochloride (CAS 1174307-69-7) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: 2-(chloromethyl)-7-methylimidazo[1,2-a]pyridine;hydrochloride. InChIKey: GWCDKJFDCLMCSE-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2-(chloromethyl)-7-methylimidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | GWCDKJFDCLMCSE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)CCl.Cl |
Computed by PubChem (NCBI)