CAS 2384037-16-3 is the registry number for 2,4-Dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline (CAS 2384037-16-3) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: 2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline. InChIKey: FZDKNAIGQIBILC-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline |
| InChIKey | FZDKNAIGQIBILC-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)