CAS 1512101-43-7 is the registry number for 2,4-Dichloro-7,7-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7,7-dimethyl-5,6-dihydrocyclopenta[d]pyrimidine (CAS 1512101-43-7) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: 2,4-dichloro-7,7-dimethyl-5,6-dihydrocyclopenta[d]pyrimidine. InChIKey: SNZVRPRZSBMBGV-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2,4-dichloro-7,7-dimethyl-5,6-dihydrocyclopenta[d]pyrimidine |
| InChIKey | SNZVRPRZSBMBGV-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C1N=C(N=C2Cl)Cl)C |
Computed by PubChem (NCBI)