CAS 93905-64-7 is the registry number for 2-(Chloromethyl)-6-methyl-1h-benzimidazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(chloromethyl)-6-methyl-1H-benzimidazole;hydrochloride (CAS 93905-64-7) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-1H-benzimidazole;hydrochloride. InChIKey: QSSHAAPOQLEKGA-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methyl-1H-benzimidazole;hydrochloride |
| InChIKey | QSSHAAPOQLEKGA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)CCl.Cl |
Computed by PubChem (NCBI)