Products 93905-64-7

CAS 93905-64-7 is the registry number for 2-(Chloromethyl)-6-methyl-1h-benzimidazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(chloromethyl)-6-methyl-1H-benzimidazole;hydrochloride (CAS 93905-64-7) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-1H-benzimidazole;hydrochloride. InChIKey: QSSHAAPOQLEKGA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Cl2N2
Molecular weight217.09 g/mol
IUPAC name2-(chloromethyl)-6-methyl-1H-benzimidazole;hydrochloride
InChIKeyQSSHAAPOQLEKGA-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)N=C(N2)CCl.Cl

Computed by PubChem (NCBI)