CAS 68740-47-6 appears in our catalog under these names: 5-(Chloromethyl)-2-methyl-1H-1,3-benzodiazole hydrochloride, 95%, 5-(Chloromethyl)-2-methyl-1H-1,3-benzodiazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-(chloromethyl)-2-methyl-1H-benzimidazole;hydrochloride (CAS 68740-47-6) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: 6-(chloromethyl)-2-methyl-1H-benzimidazole;hydrochloride. InChIKey: MAWVFDNIFOAPNL-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 6-(chloromethyl)-2-methyl-1H-benzimidazole;hydrochloride |
| InChIKey | MAWVFDNIFOAPNL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)CCl.Cl |
Computed by PubChem (NCBI)