CAS 2172185-59-8 appears in our catalog under these names: Isoquinolin-7-amine dihydrochloride, 95%, Isoquinolin-7-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
Isoquinolin-7-amine;dihydrochloride (CAS 2172185-59-8) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: isoquinolin-7-amine;dihydrochloride. InChIKey: AFMPCNJFSHIRSC-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | isoquinolin-7-amine;dihydrochloride |
| InChIKey | AFMPCNJFSHIRSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN=C2)N.Cl.Cl |
Computed by PubChem (NCBI)