Products 1174748-30-1
CAS 1174748-30-1 is the registry number for Pregabalin arenacarbil. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-5-methyl-3-[[[(1R)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]hexanoic acid (CAS 1174748-30-1) is a chemical compound with the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. IUPAC name: (3S)-5-methyl-3-[[[(1R)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]hexanoic acid. InChIKey: YDHZNJWFIYERIF-NEPJUHHUSA-N.
| Molecular formula | C15H27NO6 |
|---|---|
| Molecular weight | 317.38 g/mol |
| IUPAC name | (3S)-5-methyl-3-[[[(1R)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]hexanoic acid |
| InChIKey | YDHZNJWFIYERIF-NEPJUHHUSA-N |
| SMILES | C[C@H](OC(=O)C(C)C)OC(=O)NC[C@@H](CC(C)C)CC(=O)O |
Computed by PubChem (NCBI)