Products 1803252-74-5
CAS 1803252-74-5 is the registry number for (L)-Suberyl Carnitine-d3 Inner Salt. Offered by: TRC. Available pack sizes: 50mg.
(3R)-3-(7-carboxyheptanoyloxy)-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate (CAS 1803252-74-5) is a chemical compound with the molecular formula C15H27NO6 and a molecular weight of 320.40 g/mol. IUPAC name: (3R)-3-(7-carboxyheptanoyloxy)-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate. InChIKey: YVWVEIPYMGBQPE-LBBMYNEISA-N.
| Molecular formula | C15H27NO6 |
|---|---|
| Molecular weight | 320.40 g/mol |
| IUPAC name | (3R)-3-(7-carboxyheptanoyloxy)-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate |
| InChIKey | YVWVEIPYMGBQPE-LBBMYNEISA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)CCCCCCC(=O)O |
Computed by PubChem (NCBI)