CAS 24277-38-1 appears in our catalog under these names: 1-tert-butyl 5-methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}pentanedioate, 98%, N-Boc 1-O-t-Butyl 5-O-Methoxy L-Glutamic Acid, 1–(tert–Butyl) 5–methyl (tert–butoxycarbonyl)–L–glutamate, Boc-Glu(OMe)-OtBu 98%, (S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 10mg, 25mg, 50mg, 100g, 10g, 25g.
1-O-tert-butyl 5-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 24277-38-1) is a chemical compound with the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: IURKEBKDWQGPJJ-JTQLQIEISA-N.
| Molecular formula | C15H27NO6 |
|---|---|
| Molecular weight | 317.38 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | IURKEBKDWQGPJJ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)