CAS 1212311-50-6 is the registry number for (2S)-1-(tert-Butoxycarbonyl)-4,4-diethoxypiperidine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4,4-diethoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 1212311-50-6) is a chemical compound with the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. IUPAC name: (2S)-4,4-diethoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: XXSYJWAGVUPLGD-NSHDSACASA-N.
| Molecular formula | C15H27NO6 |
|---|---|
| Molecular weight | 317.38 g/mol |
| IUPAC name | (2S)-4,4-diethoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | XXSYJWAGVUPLGD-NSHDSACASA-N |
| SMILES | CCOC1(CCN([C@@H](C1)C(=O)O)C(=O)OC(C)(C)C)OCC |
Computed by PubChem (NCBI)