CAS 18635-51-3 appears in our catalog under these names: 5-tert-butyl 1-methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}pentanedioate, 95%, (S)-5-tert-Butyl 1-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate, 97%, 5–(tert–Butyl)1–methyl(tert–Butoxycarbonyl)–l–glutamate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g.
5-O-tert-butyl 1-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 18635-51-3) is a chemical compound with the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. IUPAC name: 5-O-tert-butyl 1-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: QJMOKJOSDZAYSQ-JTQLQIEISA-N.
| Molecular formula | C15H27NO6 |
|---|---|
| Molecular weight | 317.38 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | QJMOKJOSDZAYSQ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)