Products 156143-34-9
CAS 156143-34-9 is the registry number for 5-tert-butyl 1-methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}pentanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-O-tert-butyl 1-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 156143-34-9) is a chemical compound with the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. IUPAC name: 5-O-tert-butyl 1-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: QJMOKJOSDZAYSQ-SNVBAGLBSA-N.
| Molecular formula | C15H27NO6 |
|---|---|
| Molecular weight | 317.38 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | QJMOKJOSDZAYSQ-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)