Products 117490-39-8
CAS 117490-39-8 appears in our catalog under these names: Theophylline-d6 (Dimenhydrinate EP Impurity A-d6, Diprophylline EP Impurity B-d6), Theophylline-d6, >95% (HPLC), Theophylline-d6 (dimethyl-d6), 99 atom % D, min 98% Chemical Purity, Theophylline–d6, Theophylline-d6. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 2,5mg, 25mg, 0,1g, 0,05g, 1mg, 5mg, 500μg.
1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione (CAS 117490-39-8) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 186.20 g/mol. IUPAC name: 1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione. InChIKey: ZFXYFBGIUFBOJW-WFGJKAKNSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione |
| InChIKey | ZFXYFBGIUFBOJW-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C(=O)N(C1=O)C([2H])([2H])[2H])NC=N2 |
Computed by PubChem (NCBI)
Synonyms:
1,3-Bis((~2~H_3_)methyl)-3,7-dihydro-1H-purine-2,6-dione, 1,3-Bis[(~2~H_3_)methyl]-3,7-dihydro-1H-purine-2,6-dione, Theophylline-d6, 1,3-Bis(trideuteriomethyl)-7H-purine-2,6-dione, Theophylline-d6 (dimethyl-d6), 3,9-Dihydro-1,3-dimethyl-, orb1738151, orb2300188, 1,3-bis(trideuteriomethyl)-9H-purine-2,6-dione, 1,3-di(?H?)methyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione