CAS 84718-95-6 is the registry number for Theophylline-1,3-15N2-2-13C. Offered by: TRC. Available pack sizes: 25mg.
1,3-dimethyl-7H-purine-2,6-dione (CAS 84718-95-6) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 183.14 g/mol. IUPAC name: 1,3-dimethyl-7H-purine-2,6-dione. InChIKey: ZFXYFBGIUFBOJW-NBLDSOAPSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 183.14 g/mol |
| IUPAC name | 1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | ZFXYFBGIUFBOJW-NBLDSOAPSA-N |
| SMILES | C[15N]1C2=C(C(=O)[15N]([13C]1=O)C)NC=N2 |
Computed by PubChem (NCBI)