Products 1175565-19-1
CAS 1175565-19-1 is the registry number for (3-((Piperidin-1-ylsulfonyl)methyl)phenyl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
[3-(piperidin-1-ylsulfonylmethyl)phenyl]boronic acid (CAS 1175565-19-1) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: [3-(piperidin-1-ylsulfonylmethyl)phenyl]boronic acid. InChIKey: FVQBMCHCJWGLER-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | [3-(piperidin-1-ylsulfonylmethyl)phenyl]boronic acid |
| InChIKey | FVQBMCHCJWGLER-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CS(=O)(=O)N2CCCCC2)(O)O |
Computed by PubChem (NCBI)