Products 117570-76-0
CAS 117570-76-0 appears in our catalog under these names: 2-(8-Methyl-9-oxo-9h-xanthen-4-yl)acetic acid, 95%, 2-(8-Methyl-9-oxo-9H-xanthen-4-yl)acetic acid, 95+%, 8-Methylxanthen-9-one-4-acetic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 500mg.
2-(8-methyl-9-oxoxanthen-4-yl)acetic acid (CAS 117570-76-0) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 2-(8-methyl-9-oxoxanthen-4-yl)acetic acid. InChIKey: LOMULPZJAGQWGF-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 2-(8-methyl-9-oxoxanthen-4-yl)acetic acid |
| InChIKey | LOMULPZJAGQWGF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)OC3=C(C=CC=C3C2=O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
8-Methylxanthen-9-one-4-acetic acid, 8-Methylxanthenone-4-acetic acid, 2-(8-methyl-9-oxoxanthen-4-yl)acetic acid, 9H-Xanthene-4-acetic acid, 8-methyl-9-oxo-, 8-Me-XAA, 8-Mexaa, 8-Methylxanthanone acetic acid, 2-(1-methyl-9-oxo-9H-xanthen-5-yl)acetic acid, 2-(8-methyl-9-oxo-xanthen-4-yl)acetic acid, (8-Methyl-9-oxo-9H-xanthen-4-yl)acetic acid