Products 1176456-11-3
CAS 1176456-11-3 is the registry number for Axl-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(1-methylpyrazol-4-yl)-1H-indazol-6-amine (CAS 1176456-11-3) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-1H-indazol-6-amine. InChIKey: OOVAXGTZPIPYHR-UHFFFAOYSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 213.24 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)-1H-indazol-6-amine |
| InChIKey | OOVAXGTZPIPYHR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NNC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)
Synonyms:
Axl-IN-4, orb1689749