CAS 1176721-33-7 appears in our catalog under these names: (2-((5-Chloropyridin-2-yl)amino)-1,3-thiazol-4-yl)acetic acid, 95%, 2-{2-((5-Chloropyridin-2-yl)amino)-1,3-thiazol-4-yl}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[2-[(5-chloro-2-pyridinyl)amino]-1,3-thiazol-4-yl]acetic acid (CAS 1176721-33-7) is a chemical compound with the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. IUPAC name: 2-[2-[(5-chloro-2-pyridinyl)amino]-1,3-thiazol-4-yl]acetic acid. InChIKey: WIOGHRQAKIRMAP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2S |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | 2-[2-[(5-chloro-2-pyridinyl)amino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | WIOGHRQAKIRMAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)