CAS 622803-93-4 is the registry number for 6-Chloro-N-(pyridin-2-yl)pyridine-3-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-chloro-N-pyridin-2-ylpyridine-3-sulfonamide (CAS 622803-93-4) is a chemical compound with the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. IUPAC name: 6-chloro-N-pyridin-2-ylpyridine-3-sulfonamide. InChIKey: JKSGRKZYGYCNAW-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2S |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | 6-chloro-N-pyridin-2-ylpyridine-3-sulfonamide |
| InChIKey | JKSGRKZYGYCNAW-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NS(=O)(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)