CAS 66297-69-6 appears in our catalog under these names: ([4-(3-Chlorophenyl)-4h-1,2,4-triazol-3-yl]thio)acetic acid, 95%, {(4-(3-Chlorophenyl)-4H-1,2,4-triazol-3-yl)thio}acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 66297-69-6) is a chemical compound with the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. IUPAC name: 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: PAHLYSDTLRDXMN-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2S |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | PAHLYSDTLRDXMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C=NN=C2SCC(=O)O |
Computed by PubChem (NCBI)