Products 1384673-05-5
CAS 1384673-05-5 is the registry number for 3-Chloro-4-hydroxy-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-hydroxy-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide (CAS 1384673-05-5) is a chemical compound with the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. IUPAC name: 3-chloro-4-hydroxy-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide. InChIKey: BJPWIPCOODLITE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2S |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | 3-chloro-4-hydroxy-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide |
| InChIKey | BJPWIPCOODLITE-UHFFFAOYSA-N |
| SMILES | CC1=NSC(=N1)NC(=O)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)