CAS 77161-50-3 is the registry number for 2-((p-Aminophenyl)sulphonyl)-3-chloropyrazine. Offered by: TRC. Available pack sizes: 500mg.
4-(3-chloropyrazin-2-yl)sulfonylaniline (CAS 77161-50-3) is a chemical compound with the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. IUPAC name: 4-(3-chloropyrazin-2-yl)sulfonylaniline. InChIKey: FNUHIPZGJTYGNP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2S |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | 4-(3-chloropyrazin-2-yl)sulfonylaniline |
| InChIKey | FNUHIPZGJTYGNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=NC=CN=C2Cl |
Computed by PubChem (NCBI)