CAS 851116-15-9 is the registry number for 2-[3-(4-chlorophenyl)-5-sulfanylidene-4,5-dihydro-1H-1,2,4-triazol-4-yl]acetic acid, 95%. Offered by: Fluorochem. Available pack sizes: 100mg.
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetic acid (CAS 851116-15-9) is a chemical compound with the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. IUPAC name: 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetic acid. InChIKey: OWNDSFNHTCIVEX-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2S |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetic acid |
| InChIKey | OWNDSFNHTCIVEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)N2CC(=O)O)Cl |
Computed by PubChem (NCBI)