CAS 1177220-28-8 is the registry number for (3-Aminophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
(3-aminophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone (CAS 1177220-28-8) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: (3-aminophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone. InChIKey: CGYQQXGDGASFPI-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | (3-aminophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| InChIKey | CGYQQXGDGASFPI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)