Products 1177322-67-6

CAS 1177322-67-6 is the registry number for 2-Cyclohexylpiperidine oxalate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-cyclohexylpiperidine;oxalic acid (CAS 1177322-67-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 2-cyclohexylpiperidine;oxalic acid. InChIKey: NYNKIQIVKJEQOK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H23NO4
Molecular weight257.33 g/mol
IUPAC name2-cyclohexylpiperidine;oxalic acid
InChIKeyNYNKIQIVKJEQOK-UHFFFAOYSA-N
SMILESC1CCC(CC1)C2CCCCN2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)