CAS 1177351-07-3 is the registry number for N-(2-Amino-4-chlorophenyl)-n,n-dimethylamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-chloro-1-N,1-N-dimethylbenzene-1,2-diamine;dihydrochloride (CAS 1177351-07-3) is a chemical compound with the molecular formula C8H13Cl3N2 and a molecular weight of 243.6 g/mol. IUPAC name: 4-chloro-1-N,1-N-dimethylbenzene-1,2-diamine;dihydrochloride. InChIKey: ASFCCBCPOMBAGT-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl3N2 |
|---|---|
| Molecular weight | 243.6 g/mol |
| IUPAC name | 4-chloro-1-N,1-N-dimethylbenzene-1,2-diamine;dihydrochloride |
| InChIKey | ASFCCBCPOMBAGT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)