CAS 2173091-65-9 is the registry number for 1-(4-Chloro-3,5-dimethylpyridin-2-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(4-chloro-3,5-dimethyl-2-pyridinyl)methanamine;dihydrochloride (CAS 2173091-65-9) is a chemical compound with the molecular formula C8H13Cl3N2 and a molecular weight of 243.6 g/mol. IUPAC name: (4-chloro-3,5-dimethyl-2-pyridinyl)methanamine;dihydrochloride. InChIKey: UQCAQCVTTHXWDL-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl3N2 |
|---|---|
| Molecular weight | 243.6 g/mol |
| IUPAC name | (4-chloro-3,5-dimethyl-2-pyridinyl)methanamine;dihydrochloride |
| InChIKey | UQCAQCVTTHXWDL-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1Cl)C)CN.Cl.Cl |
Computed by PubChem (NCBI)