CAS 40658-64-8 is the registry number for 1-(4-Chlorophenyl)ethane-1,2-diamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-(4-chlorophenyl)ethane-1,2-diamine;dihydrochloride (CAS 40658-64-8) is a chemical compound with the molecular formula C8H13Cl3N2 and a molecular weight of 243.6 g/mol. IUPAC name: 1-(4-chlorophenyl)ethane-1,2-diamine;dihydrochloride. InChIKey: DNVCBKWSTIEQSN-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl3N2 |
|---|---|
| Molecular weight | 243.6 g/mol |
| IUPAC name | 1-(4-chlorophenyl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | DNVCBKWSTIEQSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CN)N)Cl.Cl.Cl |
Computed by PubChem (NCBI)