Products 40658-64-8

CAS 40658-64-8 is the registry number for 1-(4-Chlorophenyl)ethane-1,2-diamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-chlorophenyl)ethane-1,2-diamine;dihydrochloride (CAS 40658-64-8) is a chemical compound with the molecular formula C8H13Cl3N2 and a molecular weight of 243.6 g/mol. IUPAC name: 1-(4-chlorophenyl)ethane-1,2-diamine;dihydrochloride. InChIKey: DNVCBKWSTIEQSN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13Cl3N2
Molecular weight243.6 g/mol
IUPAC name1-(4-chlorophenyl)ethane-1,2-diamine;dihydrochloride
InChIKeyDNVCBKWSTIEQSN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(CN)N)Cl.Cl.Cl

Computed by PubChem (NCBI)