CAS 127951-77-3 appears in our catalog under these names: (4-Amino-2-chlorophenyl)dimethylamine dihydrochloride, 95%, (4-Amino-2-chlorophenyl)dimethylamine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine;dihydrochloride (CAS 127951-77-3) is a chemical compound with the molecular formula C8H13Cl3N2 and a molecular weight of 243.6 g/mol. IUPAC name: 2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine;dihydrochloride. InChIKey: RHTYHESBZVFRDD-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl3N2 |
|---|---|
| Molecular weight | 243.6 g/mol |
| IUPAC name | 2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine;dihydrochloride |
| InChIKey | RHTYHESBZVFRDD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)N)Cl.Cl.Cl |
Computed by PubChem (NCBI)