CAS 1373223-72-3 is the registry number for 1-(4-Chloro-pyridin-2-yl)-1-methyl-ethylamine dihydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 100mg.
2-(4-chloro-2-pyridinyl)propan-2-amine;dihydrochloride (CAS 1373223-72-3) is a chemical compound with the molecular formula C8H13Cl3N2 and a molecular weight of 243.6 g/mol. IUPAC name: 2-(4-chloro-2-pyridinyl)propan-2-amine;dihydrochloride. InChIKey: QPPITZULMOSCBF-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl3N2 |
|---|---|
| Molecular weight | 243.6 g/mol |
| IUPAC name | 2-(4-chloro-2-pyridinyl)propan-2-amine;dihydrochloride |
| InChIKey | QPPITZULMOSCBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC=CC(=C1)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)