CAS 2228651-97-4 is the registry number for 5-Chloro-N1-ethylbenzene-1,2-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-chloro-2-N-ethylbenzene-1,2-diamine;dihydrochloride (CAS 2228651-97-4) is a chemical compound with the molecular formula C8H13Cl3N2 and a molecular weight of 243.6 g/mol. IUPAC name: 4-chloro-2-N-ethylbenzene-1,2-diamine;dihydrochloride. InChIKey: DXHOUAKCWKSIHM-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl3N2 |
|---|---|
| Molecular weight | 243.6 g/mol |
| IUPAC name | 4-chloro-2-N-ethylbenzene-1,2-diamine;dihydrochloride |
| InChIKey | DXHOUAKCWKSIHM-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=CC(=C1)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)