Products 117738-82-6
CAS 117738-82-6 appears in our catalog under these names: 3–Cyano–4–methoxybenzoic acid, 3-Cyano-4-methoxybenzoicacid, 3-Cyano-4-methoxybenzoic acid 95%, 3-Cyano-4-methoxybenzoic acid, 95%, 95%, 3-Cyano-4-methoxybenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 500mg.
3-cyano-4-methoxybenzoic acid (CAS 117738-82-6) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 3-cyano-4-methoxybenzoic acid. InChIKey: OTZHDJMZVQTSBJ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-cyano-4-methoxybenzoic acid |
| InChIKey | OTZHDJMZVQTSBJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)C#N |
Computed by PubChem (NCBI)