CAS 62484-39-3 is the registry number for 2,8-Dichloro-4(3H)-quinazolinone. Offered by: TRC. Available pack sizes: 2,5g.
2,8-dichloro-3H-quinazolin-4-one (CAS 62484-39-3) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 2,8-dichloro-3H-quinazolin-4-one. InChIKey: KZOUNLZLYUDZPW-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 2,8-dichloro-3H-quinazolin-4-one |
| InChIKey | KZOUNLZLYUDZPW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(NC2=O)Cl |
Computed by PubChem (NCBI)