CAS 158580-85-9 appears in our catalog under these names: 2-Benzenesulfonamido-4-chlorobenzoic acid, 95%, 2-Benzenesulfonamido-4-chlorobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(benzenesulfonamido)-4-chlorobenzoic acid (CAS 158580-85-9) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 2-(benzenesulfonamido)-4-chlorobenzoic acid. InChIKey: QTUISZDXQYLLGF-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 2-(benzenesulfonamido)-4-chlorobenzoic acid |
| InChIKey | QTUISZDXQYLLGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)