CAS 1179673-92-7 appears in our catalog under these names: 2-((3-Chlorophenyl)(cyanomethyl)amino)acetic acid, 95%, 2-((3-Chlorophenyl)(cyanomethyl)amino)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[3-chloro-N-(cyanomethyl)anilino]acetic acid (CAS 1179673-92-7) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 2-[3-chloro-N-(cyanomethyl)anilino]acetic acid. InChIKey: GMWKRMYQFTWUIT-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-[3-chloro-N-(cyanomethyl)anilino]acetic acid |
| InChIKey | GMWKRMYQFTWUIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N(CC#N)CC(=O)O |
Computed by PubChem (NCBI)