Products 1179835-68-7
CAS 1179835-68-7 appears in our catalog under these names: 3-{((Pyrimidin-2-yl)amino)methyl}benzoic acid, 3-{[(Pyrimidin-2-yl)amino]methyl}benzoic acid, 98%, 3-((Pyrimidin-2-ylamino)methyl)benzoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
3-[(pyrimidin-2-ylamino)methyl]benzoic acid (CAS 1179835-68-7) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: 3-[(pyrimidin-2-ylamino)methyl]benzoic acid. InChIKey: AYTHLTZRUGYWCB-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-[(pyrimidin-2-ylamino)methyl]benzoic acid |
| InChIKey | AYTHLTZRUGYWCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CNC2=NC=CC=N2 |
Computed by PubChem (NCBI)