CAS 118000-40-1 is the registry number for 2-(Chloromethyl)-6-methylimidazo(1,2-a)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 25g, 5g.
2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride (CAS 118000-40-1) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: 2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride. InChIKey: BNAOKMVYFOMSDX-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | BNAOKMVYFOMSDX-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)CCl.Cl |
Computed by PubChem (NCBI)