CAS 1181245-77-1 is the registry number for 2,5-Dichloro-7-methyl-1,3-benzoxazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,5-dichloro-7-methyl-1,3-benzoxazole (CAS 1181245-77-1) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2,5-dichloro-7-methyl-1,3-benzoxazole. InChIKey: OZSHCLAIZGBQOB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2,5-dichloro-7-methyl-1,3-benzoxazole |
| InChIKey | OZSHCLAIZGBQOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OC(=N2)Cl)Cl |
Computed by PubChem (NCBI)