Products 1181408-55-8

CAS 1181408-55-8 is the registry number for 2-(1-(Methylsulfonyl)piperidin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(1-methylsulfonylpiperidin-2-yl)acetic acid (CAS 1181408-55-8) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: 2-(1-methylsulfonylpiperidin-2-yl)acetic acid. InChIKey: IHHHNZBSKZVKMG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO4S
Molecular weight221.28 g/mol
IUPAC name2-(1-methylsulfonylpiperidin-2-yl)acetic acid
InChIKeyIHHHNZBSKZVKMG-UHFFFAOYSA-N
SMILESCS(=O)(=O)N1CCCCC1CC(=O)O

Computed by PubChem (NCBI)