Products 893729-47-0

CAS 893729-47-0 is the registry number for N-(1,1-Dioxidotetrahydro-3-thienyl)-n-methyl-beta-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(1,1-dioxothiolan-3-yl)-methylamino]propanoic acid (CAS 893729-47-0) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: 3-[(1,1-dioxothiolan-3-yl)-methylamino]propanoic acid. InChIKey: BCZCMHSRGXIZGY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO4S
Molecular weight221.28 g/mol
IUPAC name3-[(1,1-dioxothiolan-3-yl)-methylamino]propanoic acid
InChIKeyBCZCMHSRGXIZGY-UHFFFAOYSA-N
SMILESCN(CCC(=O)O)C1CCS(=O)(=O)C1

Computed by PubChem (NCBI)