CAS 1250287-78-5 appears in our catalog under these names: Ethyl 4-amino-1,1-dioxothiane-4-carboxylate, 95%, Ethyl 4-aminotetrahydro-2H-thiopyran-4-carboxylate 1,1-dioxide, 98+%, Ethyl 4–amino–1,1–dioxothiane–4–carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 10g, 250mg.
Ethyl 4-amino-1,1-dioxothiane-4-carboxylate (CAS 1250287-78-5) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: ethyl 4-amino-1,1-dioxothiane-4-carboxylate. InChIKey: WTIHPLZPMBKXSZ-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | ethyl 4-amino-1,1-dioxothiane-4-carboxylate |
| InChIKey | WTIHPLZPMBKXSZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCS(=O)(=O)CC1)N |
Computed by PubChem (NCBI)