CAS 1341635-19-5 is the registry number for Ethyl 3-aminotetrahydro-2H-thiopyran-3-carboxylate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-amino-1,1-dioxothiane-3-carboxylate (CAS 1341635-19-5) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: ethyl 3-amino-1,1-dioxothiane-3-carboxylate. InChIKey: BDPCYODGHFPIKL-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | ethyl 3-amino-1,1-dioxothiane-3-carboxylate |
| InChIKey | BDPCYODGHFPIKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCCS(=O)(=O)C1)N |
Computed by PubChem (NCBI)