Products 702670-32-4
CAS 702670-32-4 appears in our catalog under these names: 1-(Ethylsulfonyl)piperidine-4-carboxylic acid, 95%, 1-(Ethylsulfonyl)piperidine-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g, 25g.
1-ethylsulfonylpiperidine-4-carboxylic acid (CAS 702670-32-4) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: 1-ethylsulfonylpiperidine-4-carboxylic acid. InChIKey: FXILSJTWIHHRJV-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | 1-ethylsulfonylpiperidine-4-carboxylic acid |
| InChIKey | FXILSJTWIHHRJV-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-(ethanesulfonyl)piperidine-4-carboxylic acid, 1-(ethylsulfonyl)piperidine-4-carboxylic acid, 1-ethylsulfonylpiperidine-4-carboxylic acid, 1-Ethanesulfonyl-piperidine-4-carboxylic acid, 4-piperidinecarboxylic acid, 1-(ethylsulfonyl)-, Te0, 1-(ethylsulfonyl)piperidine-4-carboxylicacid, 1-(ethylsulfonyl)-4-piperidinecarboxylic acid