CAS 1250736-96-9 is the registry number for Methyl 2-(1,1-dioxidothiomorpholino)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate (CAS 1250736-96-9) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate. InChIKey: SZBWRIKDJLNNAA-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
| InChIKey | SZBWRIKDJLNNAA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)N1CCS(=O)(=O)CC1 |
Computed by PubChem (NCBI)