Products 1181787-27-8

CAS 1181787-27-8 is the registry number for 2-(2,6-Dichlorophenyl)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,6-dichlorophenyl)-2-methylpropanoic acid (CAS 1181787-27-8) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-2-methylpropanoic acid. InChIKey: PMIDCOYVCJHGTL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10Cl2O2
Molecular weight233.09 g/mol
IUPAC name2-(2,6-dichlorophenyl)-2-methylpropanoic acid
InChIKeyPMIDCOYVCJHGTL-UHFFFAOYSA-N
SMILESCC(C)(C1=C(C=CC=C1Cl)Cl)C(=O)O

Computed by PubChem (NCBI)