CAS 1181787-27-8 is the registry number for 2-(2,6-Dichlorophenyl)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichlorophenyl)-2-methylpropanoic acid (CAS 1181787-27-8) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-2-methylpropanoic acid. InChIKey: PMIDCOYVCJHGTL-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-2-methylpropanoic acid |
| InChIKey | PMIDCOYVCJHGTL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)