Products 1182838-09-0
CAS 1182838-09-0 is the registry number for Methyl syringate-d6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Methyl 4-hydroxy-3,5-bis(trideuteriomethoxy)benzoate (CAS 1182838-09-0) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 218.24 g/mol. IUPAC name: methyl 4-hydroxy-3,5-bis(trideuteriomethoxy)benzoate. InChIKey: ZMXJAEGJWHJMGX-WFGJKAKNSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 218.24 g/mol |
| IUPAC name | methyl 4-hydroxy-3,5-bis(trideuteriomethoxy)benzoate |
| InChIKey | ZMXJAEGJWHJMGX-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1O)OC([2H])([2H])[2H])C(=O)OC |
Computed by PubChem (NCBI)