Products 1183393-07-8
CAS 1183393-07-8 is the registry number for 3-Amino-4-(4-ethoxyphenoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-4-(4-ethoxyphenoxy)benzoic acid (CAS 1183393-07-8) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: 3-amino-4-(4-ethoxyphenoxy)benzoic acid. InChIKey: JDHIYYQPPVAQTP-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 3-amino-4-(4-ethoxyphenoxy)benzoic acid |
| InChIKey | JDHIYYQPPVAQTP-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)OC2=C(C=C(C=C2)C(=O)O)N |
Computed by PubChem (NCBI)