CAS 1183434-97-0 appears in our catalog under these names: 4-(4-(1-Aminoethyl)phenyl)-N,N-dimethylaniline, 95%, 4-(4-(1-Aminoethyl)phenyl)-N,N-dimethylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[4-(1-aminoethyl)phenyl]-N,N-dimethylaniline (CAS 1183434-97-0) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 4-[4-(1-aminoethyl)phenyl]-N,N-dimethylaniline. InChIKey: TUQNAWCBQBBLDL-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 4-[4-(1-aminoethyl)phenyl]-N,N-dimethylaniline |
| InChIKey | TUQNAWCBQBBLDL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C2=CC=C(C=C2)N(C)C)N |
Computed by PubChem (NCBI)