CAS 1183558-44-2 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)pyrrolidin-3-amine, 95%, 1-(3,4-Dichlorophenyl)pyrrolidin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3,4-dichlorophenyl)pyrrolidin-3-amine (CAS 1183558-44-2) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)pyrrolidin-3-amine. InChIKey: JVTFJIMHNCNHEK-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)pyrrolidin-3-amine |
| InChIKey | JVTFJIMHNCNHEK-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)