CAS 1184467-10-4 is the registry number for (5-Bromo-2-fluorophenyl)methanesulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(5-bromo-2-fluorophenyl)methanesulfonyl chloride (CAS 1184467-10-4) is a chemical compound with the molecular formula C7H5BrClFO2S and a molecular weight of 287.53 g/mol. IUPAC name: (5-bromo-2-fluorophenyl)methanesulfonyl chloride. InChIKey: XFBVXYCQPMNGNR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClFO2S |
|---|---|
| Molecular weight | 287.53 g/mol |
| IUPAC name | (5-bromo-2-fluorophenyl)methanesulfonyl chloride |
| InChIKey | XFBVXYCQPMNGNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)